Información del producto
Nombre:2-Hydroxyisophthalaldehyde
Marca:Biosynth
Descripción:2-Hydroxyisophthalaldehyde is a molecule that is the product of imine formation. It has coordination geometry in which the nitrogen atom is chelated to two oxygen atoms and one proton. The molecule has an imine nitrogen atom and a chelate ring, which binds to metal ions such as copper or zinc. 2-Hydroxyisophthalaldehyde can be reduced by borohydride and exhibits tuberculostatic activity.
2-Hydroxyisophthalaldehyde can also be used to synthesize other molecules with interesting optical properties. It also has model system applications, as it is a tetranuclear compound.
2-Hydroxyisophthalaldehyde can also be used to synthesize other molecules with interesting optical properties. It also has model system applications, as it is a tetranuclear compound.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:150.13 g/mol
Fórmula:C8H6O3
Pureza:Min. 95%
InChI:InChI=1S/C8H6O3/c9-4-6-2-1-3-7(5-10)8(6)11/h1-5,11H
Clave InChI:InChIKey=JJOPQMAMJLOGFB-UHFFFAOYSA-N
SMILES:O=Cc1cccc(C=O)c1O