

Información del producto
Nombre:3-(Imidazol-1-yl)propionic acid
Sinónimos:
- 3-(1H-imidazol-1-yl)propanoic acid
Marca:Biosynth
Descripción:3-(Imidazol-1-yl)propionic acid (3IP) is a histidine analog that has been used as a radiopharmaceutical for the detection of bone resorption. In one study, 3IP was found to bind to bone and be taken up by osteoclasts, leading to an increase in the amount of light emitted. Bone resorption was observed when 3IP was administered orally and intravenously in rats. Radiopharmaceuticals are designed to emit radiation, such as beta particles or gamma rays, when they decay. This process can be used to diagnose diseases such as cancer or scurvy. Histidine is an amino acid that is important for protein synthesis and metabolism. It is also involved in the regulation of pH and the production of urea. A lack of this amino acid can lead to a variety of biochemical abnormalities, including malfunctioning enzymes that catalyze reactions involving histidine, which are essential for energy production, purine synthesis
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:140.14 g/mol
Fórmula:C6H8N2O2
Pureza:Min. 95%
InChI:InChI=1S/C6H8N2O2/c9-6(10)1-3-8-4-2-7-5-8/h2,4-5H,1,3H2,(H,9,10)
Clave InChI:InChIKey=VSFNAZLYGOOSEY-UHFFFAOYSA-N
SMILES:O=C(O)CCn1ccnc1