Información del producto
Nombre:Kaempferol-7,4'-dimethyl ether
Sinónimos:
- 3,5-Dihydroxy-4'7-dimethoxyflavone
Marca:Biosynth
Descripción:Kaempferol-7,4'-dimethyl ether is a flavonoid derivative, which is a naturally occurring compound predominantly found in certain plant species. As a derivative of kaempferol, it is an O-methylated flavonoid, often isolated from various members of the Leguminosae family. Its mode of action involves interacting with multiple biological pathways, typically exhibiting antioxidant and anti-inflammatory properties. This potent flavonoid modulates signaling pathways and can influence cellular energy metabolism, often impacting reactive oxygen species (ROS) levels.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:314.29 g/mol
Fórmula:C17H14O6
Pureza:Min. 95 Area-%
Color/Forma:Powder
InChI:InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)17-16(20)15(19)14-12(18)7-11(22-2)8-13(14)23-17/h3-8,18,20H,1-2H3
Clave InChI:InChIKey=KZBAXKKOXPLOBX-UHFFFAOYSA-N
SMILES:COc1ccc(-c2oc3cc(OC)cc(O)c3c(=O)c2O)cc1
Consulta técnica sobre: Kaempferol-7,4'-dimethyl ether
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y gestione la solicitud desde allí. Es más rápido, más barato y podrá beneficiarse de los descuentos y las ventajas disponibles.
