

Información del producto
Nombre:6-Methoxybenzo[b]thiophene
Marca:Biosynth
Descripción:6-Methoxybenzo[b]thiophene is a potent antiproliferative agent that inhibits the growth of cancer cells. It interacts with the polymerase, which is involved in DNA replication and transcription, leading to cell death. 6-Methoxybenzo[b]thiophene has been shown to inhibit the growth of carcinoma cells in vitro. It also inhibits the growth of other cancer cells by modifying cellular components such as sulfamate, which may be due to its interaction with nuclear receptors or apoptotic pathways. 6-Methoxybenzo[b]thiophene has been shown to induce death in various types of cancer cells and can also suppress tumorigenesis in vivo. This compound also has a pharmacophore that matches the size and shape of a small molecule that binds to DNA polymerase beta, suggesting that it may have similar activity at this enzyme.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:164.23 g/mol
Fórmula:C9H8OS
Pureza:Min. 95%
InChI:InChI=1S/C9H8OS/c1-10-8-3-2-7-4-5-11-9(7)6-8/h2-6H,1H3
Clave InChI:InChIKey=WGDVDMKNSDCNGB-UHFFFAOYSA-N
SMILES:COc1ccc2ccsc2c1