Información del producto
Nombre:N-Methyl-N-vinylacetamide
Sinónimos:
- N-Ethenyl-N-methyl-acetamide
Marca:Biosynth
Descripción:N-Methyl-N-vinylacetamide is a colorless liquid with a boiling point of 105.6°C. It is produced by the reaction of acetamide and vinyl chloride in the presence of hydrochloric acid, glycol ether, and methyl ethyl ketone. The viscosity of this compound is low, which makes it an ideal solvent for paints and coatings. N-Methyl-N-vinylacetamide also has genetic damaging effects and can cause mutations in bacteria that are exposed to this compound in high concentrations. This product has an unusual chemical structure due to its hydrogen bonding interactions.br>br>
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:99.13 g/mol
Fórmula:C5H9NO
Pureza:Min. 97.5%
Color/Forma:Clear Liquid
InChI:InChI=1S/C5H9NO/c1-4-6(3)5(2)7/h4H,1H2,2-3H3
Clave InChI:InChIKey=PNLUGRYDUHRLOF-UHFFFAOYSA-N
SMILES:C=CN(C)C(C)=O
Consulta técnica sobre: N-Methyl-N-vinylacetamide
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
