

Información del producto
Nombre:3-(4-Methoxybenzoyl)propionic acid
Marca:Biosynth
Descripción:3-(4-Methoxybenzoyl)propionic acid (3-MBA) is a synthetic compound that inhibits the biosynthesis of phosphatidylcholine in cells, which is required for cell growth. 3-MBA has been shown to inhibit the production of influenza virus and HIV-1 in vitro. It also has potent inotropic effects on cardiac muscle tissue and may be used as an antiarrhythmic agent. 3-MBA is rapidly absorbed following oral administration and eliminated through the kidneys. 3-MBA has a low protein binding affinity, which means it can cross the blood brain barrier. This drug also binds to leukocyte antigen and hydroxy groups, leading to dehydration reactions. 3-MBA can be converted into 2,3-dihydroxypropionic acid by dehydrating agents such as phosphoric acid solution or concentrated sulfuric acid.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:208.21 g/mol
Fórmula:C11H12O4
Pureza:Min. 95%
InChI:InChI=1S/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14)
Clave InChI:InChIKey=OMTDIBZSUZNVJK-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)CCC(=O)O)cc1