

Información del producto
Nombre:o-Methylbenzylamine
Marca:Biosynth
Descripción:o-Methylbenzylamine is a primary amine that has the chemical formula CH3C6H4NH2. It is an argon-type isomeric molecule with a phenyl group and biphenyl cavity. The molecule possesses pseudoephedrine and chiral properties. o-Methylbenzylamine has been found to be a useful substrate for chemical ionization mass spectrometry (CIMS) due to its molecular weight, molecular structure, and stability.
Amines are compounds that contain both nitrogen and hydrogen atoms in their molecules. They can be classified as primary or secondary amines depending on whether the nitrogen atom is part of the aromatic ring or not. Primary amines react with nitrous acid (HNO2) to form nitrosoamines, which are carcinogenic in nature; however, secondary amines do not react with nitrous acid because they lack an aromatic ring.
Amines are compounds that contain both nitrogen and hydrogen atoms in their molecules. They can be classified as primary or secondary amines depending on whether the nitrogen atom is part of the aromatic ring or not. Primary amines react with nitrous acid (HNO2) to form nitrosoamines, which are carcinogenic in nature; however, secondary amines do not react with nitrous acid because they lack an aromatic ring.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:121.18 g/mol
Fórmula:C8H11N
Pureza:Min. 95%
Color/Forma:Clear Liquid
InChI:InChI=1S/C8H11N/c1-7-4-2-3-5-8(7)6-9/h2-5H,6,9H2,1H3
Clave InChI:InChIKey=CJAAPVQEZPAQNI-UHFFFAOYSA-N
SMILES:Cc1ccccc1CN