Información del producto
Nombre:6-Methoxyflavone
Marca:Biosynth
Descripción:6-Methoxyflavone is a flavonoid compound, which is a naturally occurring product found in certain plants. It is characterized by the presence of a methoxy group attached to the flavone backbone. This compound is typically extracted from plant sources such as citrus fruits and certain herbs that have a high content of polyphenolic compounds. Its mode of action involves modulating various biochemical pathways, including the inhibition of specific enzymes and interaction with cellular receptors, potentially affecting oxidative stress and inflammation pathways.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:252.26 g/mol
Fórmula:C16H12O3
Pureza:Min. 95%
Color/Forma:White Powder
InChI:InChI=1S/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3
Clave InChI:InChIKey=XZQLSABETMKIGG-UHFFFAOYSA-N
SMILES:COc1ccc2oc(-c3ccccc3)cc(=O)c2c1
Consulta técnica sobre: 6-Methoxyflavone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.