Información del producto
Nombre:6-Methoxyflavanone
Marca:Biosynth
Descripción:6-Methoxyflavanone is a naturally occurring flavonoid compound, which is typically derived from plant sources, particularly those high in flavonoids such as certain fruits and herbs. The compound is characterized by the presence of a methoxy group, which distinguishes it from other flavanones and may influence its bioactivity and solubility properties. Its mode of action often involves interactions with biological pathways that regulate inflammation, oxidative stress, and cellular metabolism, potentially through mechanisms such as enzyme inhibition or modulation of receptor activity.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:254.28 g/mol
Fórmula:C16H14O3
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3
Clave InChI:InChIKey=YURQMHCZHLMHIB-UHFFFAOYSA-N
SMILES:COc1ccc2c(c1)C(=O)CC(c1ccccc1)O2
Consulta técnica sobre: 6-Methoxyflavanone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.