

Información del producto
Nombre:Methyl 5-(trifluoromethyl)-1H-pyrrole-2-carboxylate
Marca:Biosynth
Descripción:Methyl 5-(trifluoromethyl)-1H-pyrrole-2-carboxylate is a crystalline compound that belongs to the class of organic compounds known as carboxylic acids. It has a monoclinic crystal structure and may be obtained by reacting methyl pyrrole-2-carboxylate with trifluoromethylmagnesium chloride. The parameters for the crystal structure of this compound are given in the table below:
Parameter Value
Space group P2/c
Unit cell dimensions a = 12.7, b = 12.7, c = 18.4
Cell volume V = 694 Å3
Number of formula units per unit cell Z = 2
Fracture type Brittle
Parameter Value
Space group P2/c
Unit cell dimensions a = 12.7, b = 12.7, c = 18.4
Cell volume V = 694 Å3
Number of formula units per unit cell Z = 2
Fracture type Brittle
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:193.12 g/mol
Fórmula:C7H6F3NO2
Pureza:Min. 95%
InChI:InChI=1S/C7H6F3NO2/c1-13-6(12)4-2-3-5(11-4)7(8,9)10/h2-3,11H,1H3
Clave InChI:InChIKey=PQFWTUPLKUNQPO-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(C(F)(F)F)[nH]1