

Información del producto
Nombre:2-(1-Naphthyl)-2-oxoethyl thiocyanate
Sinónimos:
- thiocyanic acid
- 2-(1-naphthalenyl)-2-oxoethyl ester
Marca:Biosynth
Descripción:2-(1-Naphthyl)-2-oxoethyl thiocyanate is a versatile chemical compound that has various applications in research and industry. It is commonly used as a precursor for the synthesis of cilexetil, a prodrug used in the treatment of hypertension. The compound contains a hydrogen atom that can be easily replaced with other functional groups, making it useful for the synthesis of different derivatives. Additionally, 2-(1-Naphthyl)-2-oxoethyl thiocyanate can act as an acid-binding agent and can be used to prepare aerosol compositions or react with hydrochloric acid to form salts. Its reactivity with amines, pyrazoles, and demethylases makes it suitable for use as a solid catalyst in various chemical reactions. Furthermore, this compound has multinuclear properties and can be utilized in the synthesis of oligosaccharides and other complex molecules. Overall, 2-(1-Naphthyl)-2-
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:227.28 g/mol
Fórmula:C13H9NOS
Pureza:Min. 95%
InChI:InChI=1S/H3N/h1H3
Clave InChI:InChIKey=QGZKDVFQNNGYKY-UHFFFAOYSA-N
SMILES:N#CSCC(=O)c1cccc2ccccc12