Información del producto
Nombre:Neferine
Marca:Biosynth
Descripción:Neferine is an alkaloid, which is derived from the seeds of Nelumbo nucifera, commonly known as the lotus plant. This compound acts as a bioactive molecule with diverse pharmacological properties, primarily through its antioxidant and neuroprotective modes of action. Neferine functions by scavenging reactive oxygen species and inhibiting oxidative stress pathways, making it significant in cellular protection. Furthermore, it modulates various signaling pathways that are crucial for maintaining cellular homeostasis and survival.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:624.77 g/mol
Fórmula:C38H44N2O6
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C38H44N2O6/c1-39-15-14-27-21-36(44-5)38(23-30(27)31(39)17-24-7-10-28(42-3)11-8-24)46-34-19-25(9-12-33(34)41)18-32-29-22-37(45-6)35(43-4)20-26(29)13-16-40(32)2/h7-12,19-23,31-32,41H,13-18H2,1-6H3/t31-,32-/m1/s1
Clave InChI:InChIKey=MIBATSHDJRIUJK-ROJLCIKYSA-N
SMILES:COc1ccc(C[C@@H]2c3cc(Oc4cc(C[C@@H]5c6cc(OC)c(OC)cc6CCN5C)ccc4O)c(OC)cc3CCN2C)cc1
Consulta técnica sobre: Neferine
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.