
Ochratoxin B
CAS:
Ref. 3D-FO26490

Información del producto
Nombre:Ochratoxin B
Sinónimos:
- N-[[(3R)-3,4-Dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]-L-phenylalanineN-[(8-Hydroxy-3-methyl-1-oxo-7-isochrom anyl)carbonyl]-3-phenyl-L-alanine(R)-N-[(3,4-Dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl) carbonyl]-L-pheny
Marca:Biosynth
Descripción:Ochratoxin B is a mycotoxin that belongs to the group of toxic substances produced by fungi. It is found in animal feed and can contaminate food and water. Ochratoxin B has been shown to be genotoxic, inducing DNA damage in human serum, ochratoxin, tubule cells, and liver cells. It also inhibits the activity of complex enzymes such as DNA gyrase and topoisomerase II. The LC-MS/MS method for detecting ochratoxin B was developed based on its ability to react with an optical sensor that changes color when it binds to the substrate molecule. The hybridoma cell line was used to detect monoclonal antibodies against Ochratoxin B using a sample preparation technique with a detection sensitivity of 0.01 ng/mL.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:369.37 g/mol
Fórmula:C20H19NO6
Pureza:Min. 95%
InChI:InChI=1S/C20H19NO6/c1-11-9-13-7-8-14(17(22)16(13)20(26)27-11)18(23)21-15(19(24)25)10-12-5-3-2-4-6-12/h2-8,11,15,22H,9-10H2,1H3,(H,21,23)(H,24,25)/t11-,15+/m1/s1
Clave InChI:InChIKey=DAEYIVCTQUFNTM-ABAIWWIYSA-N
SMILES:C[C@@H]1Cc2ccc(C(=O)N[C@@H](Cc3ccccc3)C(=O)O)c(O)c2C(=O)O1