Información del producto
Nombre:Procyanidin B2
Sinónimos:
- 4,8''-Bi-[(+)-epicatechin]cis,cis''-4,8''-Bi(3,3',4',5,7-pentahydroxyflavane)
Marca:Biosynth
Descripción:Procyanidin B2 is a type of polyphenol, specifically a flavonoid compound, which is derived from plant sources such as grape seeds, apples, and cacao beans. This compound is characterized by its dimeric structure, consisting of two epicatechin units linked through a specific bond. The mode of action of Procyanidin B2 involves its function as a potent antioxidant, which allows it to neutralize free radicals and reduce oxidative stress at the cellular level. Additionally, it influences various signaling pathways, modulating enzyme activity and gene expression related to inflammation and cell survival.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:578.52 g/mol
Fórmula:C30H26O12
Pureza:Min. 98 Area-%
Color/Forma:Off-White Powder
InChI:InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1
Clave InChI:InChIKey=XFZJEEAOWLFHDH-NFJBMHMQSA-N
SMILES:Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2
Consulta técnica sobre: Procyanidin B2
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.