

Información del producto
Nombre:2-(4-Pyridyl)ethanesulfonic acid
Marca:Biosynth
Descripción:2-(4-Pyridyl)ethanesulfonic acid (2-PSES) is a flavin, which is an organic compound that contains a ribose or deoxyribose sugar molecule. 2-PSES is a functional component in the reaction solution of infectious diseases and has been shown to have anti-inflammatory properties. It has been shown to be effective in treating chronic hepatitis B virus infection and may also have potential use in the treatment of other viral infections such as HIV. 2-PSES binds to metal ions, such as technetium, through chelation. It can also bind to chloride ions through coordination geometry, which leads to transfer of the metal ion from water into the cell membrane, causing a change in membrane potential and increased permeability, leading to cell death.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:187.22 g/mol
Fórmula:C7H9NO3S
Pureza:Min. 95%
InChI:InChI=1S/C7H9NO3S/c9-12(10,11)6-3-7-1-4-8-5-2-7/h1-2,4-5H,3,6H2,(H,9,10,11)
Clave InChI:InChIKey=RGIIAYDCZSXHGL-UHFFFAOYSA-N
SMILES:O=S(=O)(O)CCc1ccncc1