Información del producto
Nombre:Prunetin
Sinónimos:
- 4',5-Dihydroxy-7-methoxyisoflavone
Marca:Biosynth
Descripción:Prunetin is a naturally occurring isoflavone, which is an organic compound derived from plant sources. It is primarily found in legumes and other plant materials where it naturally occurs as part of the plant's phytochemical arsenal. The mode of action of prunetin involves modulating various biochemical pathways, including acting as an antioxidant, influencing estrogenic activity, and affecting cellular signaling pathways. Its biochemical properties allow it to interact with multiple cellular targets, leading to its diverse biological activities.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:284.26 g/mol
Fórmula:C16H12O5
Pureza:Min. 95%
Color/Forma:Slightly Brown Powder
InChI:InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
Clave InChI:InChIKey=KQMVAGISDHMXJJ-UHFFFAOYSA-N
SMILES:COc1cc(O)c2c(=O)c(-c3ccc(O)cc3)coc2c1
Consulta técnica sobre: Prunetin
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.