Información del producto
Nombre:Trityl chloride
Sinónimos:
- Triphenylmethyl chloride
- Chlorotriphenylmethane
Marca:Biosynth
Descripción:Trityl chloride is an organic compound that has high chemical stability. It is mainly used as a reagent in organic synthesis and polymer chemistry. Trityl chloride reacts with alkanoic acids to form esters by the reaction of the acid chloride with alcohols. Trityl chloride reacts with trifluoroacetic acid to form carboxylic acid chlorides, which are often used as chiral synthons in asymmetric synthesis. The coordination geometry of the trityl ligand is octahedral and it binds to metal cations through three oxygen atoms and two adjacent nitrogen atoms. The polymer compositions can be chiral due to the presence of chiral trityl groups, which can lead to different physical properties such as solubility or melting point.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:278.78 g/mol
Fórmula:C19H15Cl
Pureza:(¹H-Nmr) Min. 95 Area-%
Color/Forma:White Powder
InChI:InChI=1S/C19H15Cl/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Clave InChI:InChIKey=JBWKIWSBJXDJDT-UHFFFAOYSA-N
SMILES:ClC(c1ccccc1)(c1ccccc1)c1ccccc1
Consulta técnica sobre: Trityl chloride
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.