Información del producto
Nombre:tert-Butyl crotonate
Marca:Biosynth
Descripción:Tert-Butyl crotonate is a synthetic compound that is used in organic synthesis. It can be prepared by the elimination of carbon dioxide from crotonic acid with sodium carbonate, which produces tert-butyl crotonate and sodium bicarbonate. Tert-Butyl crotonate can also be obtained from naphthalene through anhydrous sodium chlorite or hydrochloric acid. The chemical reactions are summarized in the following scheme:
The tert-butyl group has an asymmetric center, so there are two possible enolate forms. The enolate form on the right is more stable because it has less steric hindrance from the tert-butyl group. This means that it will react faster with carbonyl compounds to give products with higher yields.
The tert-butyl group has an asymmetric center, so there are two possible enolate forms. The enolate form on the right is more stable because it has less steric hindrance from the tert-butyl group. This means that it will react faster with carbonyl compounds to give products with higher yields.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:142.2 g/mol
Fórmula:C8H14O2
Pureza:Min. 95%
InChI:InChI=1S/C8H14O2/c1-5-6-7(9)10-8(2,3)4/h5-6H,1-4H3/b6-5+
Clave InChI:InChIKey=QHSPZGZEUDEIQM-AATRIKPKSA-N
SMILES:C/C=C/C(=O)OC(C)(C)C