

Información del producto
Nombre:2,3,4-Trichloroaniline
Marca:Biosynth
Descripción:2,3,4-Trichloroaniline (2,3,4-TCA) is a chemical that has shown to have an inhibitory effect against bacteria. It has been found in human liver tissue and is eliminated from the body at a rate of 1.7% per hour. The chemical structure of 2,3,4-TCA consists of three chlorine atoms bonded to the central carbon atom. The reaction products of 2,3,4-TCA are chloroamines. 2,3,4-TCA inhibits bacterial growth by reacting with amines and amino acids in the bacterial cell wall synthesis process. This chemical can be detected using analytical methods such as gas chromatography or liquid chromatography with mass spectroscopy detection (LC/MS). The use of this chemical for bacteria inhibition is limited because it cannot cross species lines and does not work on some strains of bacteria due to their ability to produce chloramines.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:196.46 g/mol
Fórmula:C6H4Cl3N
Pureza:Min. 95%
InChI:InChI=1S/C6H4Cl3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2
Clave InChI:InChIKey=RRJUYQOFOMFVQS-UHFFFAOYSA-N
SMILES:Nc1ccc(Cl)c(Cl)c1Cl