

Información del producto
Nombre:Trichloroisocyanuric acid
Marca:Biosynth
Descripción:Trichloroisocyanuric acid is a disinfectant that is used to treat drinking water, swimming pools, and other water supplies. It reacts with chlorine in the presence of an oxidizing agent such as potassium dichromate to produce hypochlorous acid, which is a powerful oxidizer. This chemical reaction can be catalyzed by a redox potential of less than -200 mV. The rate of reaction is dependent on the concentration of the reactants and their relative concentrations. Trichloroisocyanuric acid has been shown to have some efficacy against resistant mutants to chlorination, although it has been shown to be ineffective against mycobacteria.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:232.41 g/mol
Fórmula:C3Cl3N3O3
Pureza:Min. 95%
InChI:InChI=1S/C3Cl3N3O3/c4-7-1(10)8(5)3(12)9(6)2(7)11
Clave InChI:InChIKey=YRIZYWQGELRKNT-UHFFFAOYSA-N
SMILES:O=c1n(Cl)c(=O)n(Cl)c(=O)n1Cl