

Información del producto
Nombre:3-Trifluoromethyl pyrazole
Marca:Biosynth
Descripción:3-Trifluoromethyl pyrazole is an antagonist of the proton pump, which is responsible for secreting hydrogen and potassium ions into the stomach. It inhibits hydrogen fluoride-induced carcinogenesis in animal models by preventing the formation of reactive oxygen species. 3-Trifluoromethyl pyrazole has been shown to have a protective effect against colorectal carcinoma and inhibit tumor growth by inhibiting prostaglandin E2 (PGE2) production and nitric oxide (NO). 3-Trifluoromethyl pyrazole inhibits herpes simplex virus type 1 replication in human cells by binding to its lipid envelope. This binding prevents viral entry into host cells.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:136.08 g/mol
Fórmula:C4H3F3N2
Pureza:Min. 95%
InChI:InChI=1S/C4H3F3N2/c5-4(6,7)3-1-2-8-9-3/h1-2H,(H,8,9)
Clave InChI:InChIKey=PYXNITNKYBLBMW-UHFFFAOYSA-N
SMILES:FC(F)(F)c1ccn[nH]1