Información del producto
Nombre:Tricin 4'-methyl ether
Sinónimos:
- 5,7-Dihydroxy-3',4',5'-trimethoxyflavone
Marca:Biosynth
Descripción:Tricin 4'-methyl ether is a bioactive flavonoid, which is a phytochemical compound primarily derived from various plant sources such as rice, wheat, and maize. This compound is known for its antioxidant properties due to its phenolic structure, which allows it to scavenge free radicals and reduce oxidative stress. Additionally, Tricin 4'-methyl ether exhibits potential anti-inflammatory effects by modulating the activity of specific enzymes and pathways involved in inflammation.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:344.32 g/mol
Fórmula:C18H16O7
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3
Clave InChI:InChIKey=CPCPHNWWTJLXKQ-UHFFFAOYSA-N
SMILES:COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1OC
Consulta técnica sobre: Tricin 4'-methyl ether
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.