Información del producto
Nombre:Tricetin
Sinónimos:
- 5,7,3',4',5'-Pentahydroxyflavone
Marca:Biosynth
Descripción:Tricetin is a naturally occurring flavonoid compound, which is primarily sourced from various plant species. Its molecular structure comprises multiple hydroxyl groups, contributing to its biological activity. Tricetin functions by modulating several biochemical pathways; it exhibits antioxidant properties through scavenging of reactive oxygen species and chelation of metal ions. Additionally, Tricetin possesses anti-inflammatory effects, as it can inhibit the synthesis of pro-inflammatory cytokines and downregulate the expression of enzymes involved in inflammation, such as cyclooxygenase and lipoxygenase.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:302.24 g/mol
Fórmula:C15H10O7
Pureza:Min. 95%
Color/Forma:Yellow Powder
InChI:InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H
Clave InChI:InChIKey=ARSRJFRKVXALTF-UHFFFAOYSA-N
SMILES:O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12
Consulta técnica sobre: Tricetin
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.