Información del producto
Nombre:(S)-HPMPA
Sinónimos:
- (S)-9-[3-Hydroxy-2-(phosphonylmethoxy)propyl]adenine
Marca:Biosynth
Descripción:(S)-HPMPA is a nucleotide analogue, which is a chemically synthesized compound designed to mimic nucleotides. It acts as both an antiviral and an antitumor agent, sourced primarily through synthetic chemistry involving the modification of naturally occurring nucleotide structures. The mode of action of (S)-HPMPA involves mimicking natural substrates of various viral polymerases and cellular enzymes, thereby inhibiting viral DNA synthesis and disrupting the replication cycle of DNA viruses. Additionally, it can interfere with certain cellular pathways contributing to its antitumor effects.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:303.21 g/mol
Fórmula:C9H14N5O5P
Pureza:Min. 95%
InChI:InChI=1S/C9H14N5O5P/c10-8-7-9(12-3-11-8)14(4-13-7)1-6(2-15)19-5-20(16,17)18/h3-4,6,15H,1-2,5H2,(H2,10,11,12)(H2,16,17,18)/t6-/m0/s1
Clave InChI:InChIKey=FRPXSOOHWNMLPH-LURJTMIESA-N
SMILES:Nc1ncnc2c1ncn2C[C@@H](CO)OCP(=O)(O)O
Consulta técnica sobre: (S)-HPMPA
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.