1-Ethyl-3-methylimidazolium aminoacetate
CAS: 766537-74-0
Ref. 3D-RFB53774
| 10g | A consultar | ||
| 25g | A consultar |
Información del producto
1-Ethyl-3-methylimidazolium aminoacetate is a colorless liquid that is soluble in water and organic solvents. It has the chemical formula CH3C(NH2)CH2CH2N(CH3)COO. This compound reacts with many substances, including water and other molecules, at a relatively fast rate. The reaction rate of 1-ethyl-3-methylimidazolium aminoacetate can be measured using techniques such as absorption process, simulations, and viscosity measurements. This compound interacts with others by changing their properties such as viscosity or surface properties. The kinetic constant for this compound can be determined using techniques such as activated enhancement or surface properties.
Propiedades químicas
Consulta técnica sobre: 3D-RFB53774 1-Ethyl-3-methylimidazolium aminoacetate
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
