Información del producto
Nombre:7,8-Methylenedioxycoumarin
Marca:Biosynth
Descripción:7,8-Methylenedioxycoumarin is a furanocoumarin compound, which is a type of organic molecule characterized by a coumarin core with an additional methylenedioxy group. It is primarily sourced from various plant species, particularly those in the Rutaceae family, where it is found in essential oils and extracts. The mode of action of 7,8-Methylenedioxycoumarin involves its natural fluorescing properties, making it highly valuable for use in various biochemical assays where visualization is key. Due to its unique chemical structure, it efficiently absorbs ultraviolet light and emits visible fluorescence, which is exploited in photochemistry and as a biological marker. Its applications extend to the fields of pharmaceuticals and environmental sciences, where it serves in drug development studies and as a tool for tracking organic pollutants in ecosystems. Researchers continue to explore its potential uses due to its distinctive chemical behavior and natural origin.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:190.15 g/mol
Fórmula:C10H6O4
Pureza:Min. 95%
InChI:InChI=1S/C10H6O4/c11-8-4-2-6-1-3-7-10(9(6)14-8)13-5-12-7/h1-4H,5H2
Clave InChI:InChIKey=OZRUEXJYRHKIJC-UHFFFAOYSA-N
SMILES:O=c1ccc2ccc3c(c2o1)OCO3
Consulta técnica sobre: 7,8-Methylenedioxycoumarin
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.