Información del producto
Nombre:Pseudobaptisin
Sinónimos:
- Pseudobaptigenin 7-rhamnoglucoside3-(1,3-Benzodioxol-5-yl)-7-[[6-O-(6-deoxy-?-L-mannopyranosyl)-?-D-glucopyranosyl]oxy]-4H-1-benzop yran-4-one
Marca:Biosynth
Descripción:Pseudobaptisin is a natural organic compound that belongs to the class of isoflavones, which is primarily derived from plants, particularly the genus Baptisia. This compound is extracted from the roots and other parts of these plants and is recognized for its intricate chemical structure that exhibits diverse pharmacological activities. The mode of action of pseudobaptisin involves its ability to interact with various enzymatic and cellular pathways, often influencing signal transduction mechanisms and modulating the activity of specific proteins involved in cellular processes.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:590.53 g/mol
Fórmula:C28H30O14
Pureza:Min. 95%
InChI:InChI=1S/C28H30O14/c1-11-20(29)23(32)25(34)27(40-11)37-9-19-22(31)24(33)26(35)28(42-19)41-13-3-4-14-17(7-13)36-8-15(21(14)30)12-2-5-16-18(6-12)39-10-38-16/h2-8,11,19-20,22-29,31-35H,9-10H2,1H3
Clave InChI:InChIKey=BYSWVDZWRHOULM-UHFFFAOYSA-N
SMILES:CC1OC(OCC2OC(Oc3ccc4c(=O)c(-c5ccc6c(c5)OCO6)coc4c3)C(O)C(O)C2O)C(O)C(O)C1O
Consulta técnica sobre: Pseudobaptisin
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.