Información del producto
Nombre:Picrosteganol
Marca:Biosynth
Descripción:Picrosteganol is a naturally occurring compound that is isolated from specific plant species known for their medicinal properties. This compound is sourced primarily from Picrostegia plants, which are known for containing various bioactive phytochemicals. The mode of action of Picrosteganol involves interaction with cellular pathways that influence inflammation and oxidative stress. It is believed to modulate signaling pathways at a molecular level, thereby exhibiting anti-inflammatory and antioxidant properties.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:414.13147
Fórmula:C22H22O8
Pureza:Min. 95%
InChI:InChI=1S/C22H22O8/c1-25-16-7-13-18(21(27-3)20(16)26-2)12-6-15-14(29-9-30-15)5-10(12)4-11-8-28-22(24)17(11)19(13)23/h5-7,11,17,19,23H,4,8-9H2,1-3H3
Clave InChI:InChIKey=NFDCJWRBQDOGJP-UHFFFAOYSA-N
SMILES:COc1cc2c(c(OC)c1OC)-c1cc3c(cc1CC1COC(=O)C1C2O)OCO3
Consulta técnica sobre: Picrosteganol
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.