Building Blocks

Bicyclo[3.3.1]nonan-3-one is a bicyclic organic compound that has been shown to be an inorganic base, with a boiling point of 206°C and a melting point of -128°C. It is insoluble in water, but soluble in most organic solvents. This compound is used as an intermediate for the production of dioxane, which is used as a solvent and chemical intermediate. Bicyclo[3.3.1]nonan-3-one can also be used as an inorganic base for the preparation of methylene compounds such as ethylene oxide and propylene oxide.

N4-{7-Chloro-2-[2-(2-chloro-phenyl)-vinyl]-quinolin-4-yl}-N1,N1-diethylpentane-1,4-diamine is a small molecule that inhibits signal pathways by binding to the amine groups on proteins. It has been shown to inhibit the production of proinflammatory cytokines and chemokines in skin cancer cells. N4-(7-chloroquinolin-4-yl)-N1,N1 diethylpentaneamine also blocks the adenosine receptor, which prevents cell proliferation. This drug has been found to be effective for treating diabetic neuropathy. N4-(7 chloroquinolin 4 yl) -N1,N1 diethylpentaneamine is water soluble and structurally related to drugs such as nifedipine. It can be synthesized with an x ray crystal structure and has a red

Versatile small molecule scaffold

3'-Methylphenoxyacetamide is a chemotherapeutic agent that inhibits the growth of cancer cells. It is a glutathione S-transferase inhibitor and glutathione detoxifier. 3'-Methylphenoxyacetamide has been shown to inhibit the growth of cancer cells in vitro and in vivo, as well as to protect against oxidative stress in rats. This compound induces apoptosis by inhibiting the synthesis of proteins necessary for cell division or by preventing DNA replication.

Versatile small molecule scaffold

2-Amino-2-methylpropane hydrochloride (AMP) is a chemical compound that is used in the synthesis of pharmaceuticals. It belongs to the class of amines and has been shown to inhibit the activity of enzymes involved in the synthesis of proteins, such as protein kinase A. The chemical structure of AMP consists of a hydrogen bond between its two hydroxyl groups and an intramolecular hydrogen bond. This structural feature may explain why it is an effective inhibitor against many different enzymes.

Kinetin is a chemical compound that is used in research as a reagent, useful scaffold, and an intermediate. It has been shown to be an effective building block for the synthesis of complex compounds. Kinetin is also a versatile building block that can be used to synthesize many different types of compounds. Kinetin has a CAS number 525-79-1 and is classified as a speciality chemical.

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold

Versatile small molecule scaffold