
CAS: 2248003-87-2
Descrizione:The chemical substance with the CAS number 2248003-87-2 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical properties (including reactivity and stability). Additionally, the compound may have specific applications in various fields, such as pharmaceuticals, materials science, or agriculture, depending on its functional groups and molecular interactions. To obtain precise characteristics, including safety data, toxicity, and regulatory information, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive details about the substance in question.
Formula:C22H25FN4O4
InChI:InChI=1S/C22H25FN4O4/c1-22(2,3)31-21(28)27-15-7-5-14(6-8-15)26-20-19-17(23)11-16(30-10-9-29-4)12-18(19)24-13-25-20/h5-8,11-13H,9-10H2,1-4H3,(H,27,28)(H,24,25,26)
InChI key:InChIKey=AILPXCDEDGHWQC-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NC1=CC=C(C=C1)NC=2N=CN=C3C=C(OCCOC)C=C(F)C32
- Sinonimi:
- tert-Butyl (4-((5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl)amino)phenyl)carbamate

tert-Butyl (4-((5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl)amino)phenyl)carbamate
Ref: IN-DA01JTVR
1g | 533,00 € | ||
5g | Prezzo su richiesta | ||
100mg | 142,00 € | ||
250mg | 201,00 € |

tert-Butyl (4-((5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl)amino)phenyl)carbamate
Ref: 54-PC100486
1g | 778,00 € | ||
5g | 2.104,00 € | ||
100mg | 209,00 € | ||
250mg | 396,00 € |

Tert-Butyl (4-((5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl)amino)phenyl)carbamate
Ref: 10-F610699
1g | 399,00 € | ||
5g | 1.143,00 € | ||
100mg | 112,00 € | ||
250mg | 216,00 € |

tert-Butyl (4-((5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl)amino)phenyl)carbamate
Ref: 3D-YPD00387
1g | Fuori produzione | Richiedi informazioni | |
5g | Fuori produzione | Richiedi informazioni |