CAS 38186-86-6

6-chloro-5-fluoropyridine-3-carboxylic acid

Descrizione:

6-Chloro-5-fluoropyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and fluorine substituents at the 6th and 5th positions, respectively, contributes to its unique chemical properties, including increased reactivity and potential for forming hydrogen bonds. The carboxylic acid functional group at the 3rd position enhances its acidity and solubility in polar solvents. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its structural features may influence its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of halogens can affect the compound's lipophilicity and metabolic stability. Overall, 6-chloro-5-fluoropyridine-3-carboxylic acid is a valuable compound in the field of organic synthesis and drug discovery.

Formula: C₆H₃ClFNO₂

InChI: InChI=1/C6H3ClFNO2/c7-5-4(8)1-3(2-9-5)6(10)11/h1-2H,(H,10,11)

SMILES: c1c(cnc(c1F)Cl)C(=O)O

Sinonimi:

• 3-Pyridinecarboxylic Acid, 6-Chloro-5-Fluoro-
• 6-Chloro-5-fluoronicotinic acid

6-Chloro-5-fluoro-nicotinic acid

CAS: 38186-86-6

Formula: C₆H₃ClFNO₂

Purezza: 95%

Colore e forma: Solid

Peso molecolare: 175.5449

Ref: IN-DA00C7L1

6-Chloro-5-fluoronicotinic acid

CAS: 38186-86-6

6-Chloro-5-fluoronicotinic acid

Formula: C₆H₃ClFNO₂

Purezza: ≥95%

Colore e forma: off-white powder

Peso molecolare: 175.54g/mol

Ref: 54-PC10650

6-CHLORO-5-FLUOROPYRIDINE-3-CARBOXYLIC ACID

CAS: 38186-86-6

Formula: C₆H₃ClFNO₂

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 175.54

Ref: 10-F330686

6-Chloro-5-fluoronicotinic acid

CAS: 38186-86-6

Versatile small molecule scaffold

Formula: C₆H₃ClFNO₂

Purezza: Min. 95%

Peso molecolare: 175.55 g/mol

Ref: 3D-NBA18686