CAS: 4883-67-4 - 2-nitrocyclohexanone
Formula:C6H9NO3
InChI:InChI=1/C6H9NO3/c8-6-4-2-1-3-5(6)7(9)10/h5H,1-4H2
| Marchio | Dati del prodotto | Purezza | Fascia di prezzo | Consegna prevista |
|---|---|---|---|---|
 | 2-Nitrocyclohexanone REF: AN-AG003HSLCAS: 4883-67-4 | - - - | Prezzo su richiesta | Lun 29 Apr 24 |
 | 2-Nitrocyclohexanone REF: 54-OR929759CAS: 4883-67-4 | 95% | 195,00 €~400,00 € | Lun 06 Mag 24 |
 | 2-Nitrocyclohexanone REF: 10-F639512CAS: 4883-67-4 | 95+% | Prezzo su richiesta | Gio 09 Mag 24 |
 | 2-Nitrocyclohexanone REF: 3D-EAA88367CAS: 4883-67-4 | Min. 95% | Prezzo su richiesta | Lun 10 Giu 24 |
Ref: AN-AG003HSL
| Dimensione non definita | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Lunedì 29 Aprile 2024
Ref: 54-OR929759
| 1g | 400,00 € | |
| 250mg | 195,00 € |
Consegna stimata in Stati Uniti, il Lunedì 06 Maggio 2024
Ref: 10-F639512
| 1g | Prezzo su richiesta | |
| 5g | Prezzo su richiesta | |
| 10g | Prezzo su richiesta | |
| 2.5g | Prezzo su richiesta | |
| 500mg | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Giovedì 09 Maggio 2024
2-Nitrocyclohexanone
CAS:4883-67-4
2-Nitrocyclohexanone (2NCH) is a clinical drug that is used in the synthesis of pharmaceuticals. It …
Formula:
C6H9NO3
Purezza:
Min. 95%
Peso molecolare:
143.14 g/mol
Ref: 3D-EAA88367
| 1g | Prezzo su richiesta | |
| 5g | Prezzo su richiesta | |
| 10g | Prezzo su richiesta | |
| 250mg | Prezzo su richiesta | |
| 500mg | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Lunedì 10 Giugno 2024
