CAS: 60698-32-0 - 5-phenoxyfuran-2-carboxylic acid
Formula:C11H8O4
InChI:InChI=1/C11H8O4/c12-11(13)9-6-7-10(15-9)14-8-4-2-1-3-5-8/h1-7H,(H,12,13)
- Sinonimi:
- 2-Furancarboxylic Acid, 5-Phenoxy-
- 5-Phenoxy-2-Furoic Acid
- 5-Phenoxyfuran-2-carboxylic acid
| Marchio | Dati del prodotto | Purezza | Fascia di prezzo | Consegna prevista |
|---|---|---|---|---|
 | 5-PHENOXY-2-FUROIC ACID REF: IN-DA00EA3GCAS: 60698-32-0 | - - - | Prezzo su richiesta | Mar 07 Gen 25 |
 | 5-Phenoxy-2-furoic acid REF: 54-OR100255CAS: 60698-32-0 | - - - | Prezzo su richiesta | Mar 14 Gen 25 |
 | 5-Phenoxyfuran-2-carboxylic acid REF: 10-F676325CAS: 60698-32-0 | 95+% | - - - | Prodotto fuori produzione |
 | 5-Phenoxyfuran-2-carboxylic acid REF: 3D-KCA69832CAS: 60698-32-0 | Min. 95% | - - - | Prodotto fuori produzione |
Ref: IN-DA00EA3G
| Dimensione non definita | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Martedì 07 Gennaio 2025
Ref: 54-OR100255
| Dimensione non definita | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Martedì 14 Gennaio 2025
Ref: 10-F676325
| 1g | Fuori produzione | Richiedi informazioni | |
| 5g | Fuori produzione | Richiedi informazioni | |
| 10g | Fuori produzione | Richiedi informazioni | |
| 2.5g | Fuori produzione | Richiedi informazioni | |
| 500mg | Fuori produzione | Richiedi informazioni |
5-Phenoxyfuran-2-carboxylic acid
CAS:60698-32-0
Please enquire for more information about 5-Phenoxyfuran-2-carboxylic acid including the price, delivery time and more …
Formula:
C11H8O4
Purezza:
Min. 95%
Peso molecolare:
204.18 g/mol
Ref: 3D-KCA69832
| 1g | Fuori produzione | Richiedi informazioni | |
| 5g | Fuori produzione | Richiedi informazioni | |
| 10g | Fuori produzione | Richiedi informazioni | |
| 250mg | Fuori produzione | Richiedi informazioni | |
| 500mg | Fuori produzione | Richiedi informazioni | |
| 2500mg | Fuori produzione | Richiedi informazioni |
