CAS 90411-12-4

Neochamaejasmin B

Descrizione:

Neochamaejasmin B è un composto chimico classificato come un flavonoide, specificamente un tipo di chalcone. È derivato da fonti naturali, spesso trovato in varie piante, ed è noto per le sue potenziali attività biologiche. Il composto presenta proprietà antiossidanti, che possono contribuire al suo ruolo nella protezione delle cellule dallo stress ossidativo. Inoltre, Neochamaejasmin B è stato studiato per i suoi effetti anti-infiammatori e antimicrobici, rendendolo di interesse nella ricerca farmacologica. La sua struttura presenta tipicamente uno scheletro di flavonoide caratteristico, responsabile delle sue diverse attività biologiche. La solubilità e stabilità del composto possono variare a seconda del solvente e delle condizioni ambientali, influenzando le sue applicazioni sia nella ricerca che in contesti terapeutici potenziali. Come per molti prodotti naturali, sono necessari ulteriori studi per chiarire completamente i suoi meccanismi d'azione e i potenziali benefici per la salute.

Formula: C₃₀H₂₂O₁₀

InChI: InChI=1/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26-,29-,30+/s2

InChI key: InChIKey=RNQBLQALVMHBKH-HPZZALBMNA-N

SMILES: O=C1[C@]([C@@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)([C@]4([C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(O)C=C6)[H])[H]

Sinonimi:

• rel-(+)-(2R,2′S,3R,3′R)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,3′-bi-4H-1-benzopyran]-4,4′-dione
• (+)-Neochamaejasmin B
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, [2α,3α(2′S*,3′R*)]-(+)-
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2R,2′S,3R,3′R)-rel-(+)-
• Neochamaejasmin B

Neochamaejasmin B

CAS: 90411-12-4

Formula: C₃₀H₂₂O₁₀

Purezza: 98%

Peso molecolare: 542.4897

Ref: IN-DA00H3AT

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B

Purezza: ≥95%

Peso molecolare: 542.49g/mol

Ref: 54-BUP01902

Neochamaejasmin B

CAS: 90411-12-4

Formula: C₃₀H₂₂O₁₀

Purezza: 95%~99%

Colore e forma: Powder

Peso molecolare: 542.496

Ref: BP-SBP03132

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B displays nematicidal activity against both Bursaphelenchus xylophilus and Bursaphelenchus mucronatus.

Formula: C₃₀H₂₂O₁₀

Purezza: 97.89%

Colore e forma: Solid

Peso molecolare: 542.49

Ref: TM-TN1977

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B is a natural bioactive compound, which is derived from the roots of Stellera chamaejasme L., a plant found in various regions of Asia. This compound is classified as a flavonoid, known for its diverse range of biological activities. Its mode of action involves interacting with cellular pathways that regulate processes such as inflammation, cell proliferation, and apoptosis. This multifaceted activity makes Neochamaejasmine B an attractive candidate for research into potential therapeutic applications. Studies have highlighted its potential in the treatment of conditions such as cancer, due to its ability to inhibit specific cancer cell lines, as well as its anti-inflammatory properties which could be beneficial in chronic inflammatory diseases. As research advances, further elucidation of its molecular mechanisms and therapeutic efficacy is anticipated, contributing valuable insights into its application in medicinal chemistry and pharmacology.

Formula: C₃₀H₂₂O₁₀

Purezza: Min. 95%

Peso molecolare: 542.5 g/mol

Ref: 3D-QDA41112