Informazioni sul prodotto
Nome:2-Amino-5-methylpyridine
Marchio:Biosynth
Descrizione:2-Amino-5-methylpyridine is a chemical compound that belongs to the group of methyl ketones. It has a nitrogen atom and an oxygen atom in its structure, which allows it to form hydrogen bonds with other molecules. 2-Amino-5-methylpyridine can be obtained by reacting hydrochloric acid and xanthone in the presence of a base. The compound is highly reactive and has been shown to have antiinflammatory properties. This can be attributed to its ability to inhibit prostaglandin synthesis. 2-Amino-5-methylpyridine also has fluorescence properties that are sensitive to pH changes and can be used as a probe for metal ions.
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:108.14 g/mol
Formula:C6H8N2
Purezza:Min. 95%
Colore/Forma:Powder
InChI:InChI=1S/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)
InChI key:InChIKey=CMBSSVKZOPZBKW-UHFFFAOYSA-N
SMILES:Cc1ccc(N)nc1
Richiesta tecnica su: 2-Amino-5-methylpyridine
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine. Se si desidera richiedere un preventivo o effettuare un ordine, si prega invece di aggiungere i prodotti desiderati al carrello e poi richiedere un preventivo o un ordine dal carrello. È più veloce, più economico, e potrà beneficiare degli sconti disponibili e di altri vantaggi.
