
Acyclovir monophosphate
CAS:
Rif. 3D-FA07187

Informazioni sul prodotto
Nome:Acyclovir monophosphate
Marchio:Biosynth
Descrizione:Acyclovir is a prodrug that is converted in vivo to its active form, acyclovir monophosphate. Acyclovir monophosphate inhibits DNA synthesis by human macrophages and other cells infected with viruses. Acyclovir inhibits the activity of the human enzyme, DNA polymerase. It binds reversibly to the viral DNA polymerase, preventing it from binding to the viral DNA and synthesizing new viral DNA strands. The hydroxyl group on acyclovir monophosphate reacts with the 3'-hydroxyl group on the terminal nucleotide of each dNTP, which prevents further elongation of the strand and thus blocks viral replication. Acyclovir also inhibits other enzymes that are important for cell metabolism, such as RNA polymerases and protein kinases. Acyclovir has minimal toxicity in humans and can be used as a diagnostic agent for hepatitis virus infections or as an antiviral agent for treating wild-type
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:305.19 g/mol
Formula:C8H12N5O6P
Purezza:(%) Min. 95%
Colore/Forma:Powder
InChI:InChI=1S/C8H12N5O6P/c9-8-11-6-5(7(14)12-8)10-3-13(6)4-18-1-2-19-20(15,16)17/h3H,1-2,4H2,(H2,15,16,17)(H3,9,11,12,14)
InChI key:InChIKey=KUOAJOVOKFATQE-UHFFFAOYSA-N
SMILES:Nc1nc2c(ncn2COCCOP(=O)(O)O)c(=O)[nH]1