
4-Aminopyridine N-oxide
CAS:
Rif. 3D-FA17842

Informazioni sul prodotto
Nome:4-Aminopyridine N-oxide
Sinonimi:
- 4-Pyridinamine 1-oxide4-Aminopyridine 1-oxideNSC 351983
Marchio:Biosynth
Descrizione:4-Aminopyridine N-oxide is a white, crystalline solid that is soluble in water and alcohol. It has a molecular weight of 128.2 and formula weight of 135.2. 4-Aminopyridine N-oxide reacts with acid solutions to produce nitrous acid and ammonia gas. The rate of the reaction depends on the concentration of aminopyridine and aniline, as well as the pH of the solution. The acetylation, diazotisation, and kinetics have also been studied extensively for this compound. Nitrous acid can react with amides to form azulene, which can then react with amines to form a molecule containing nitrogen, oxygen, carbon, hydrogen and one other element or compound from each group (e.g., NHCOCH). This reaction is reversible when solvents are present.br> 4-Aminopyridine N-oxide may be used as a precursor for other organic
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:110.11 g/mol
Formula:C5H6N2O
Purezza:Min. 95%
Colore/Forma:Slightly Yellow Powder
InChI:InChI=1S/C5H6N2O/c6-5-1-3-7(8)4-2-5/h1-4,6,8H
InChI key:InChIKey=SJQWWHFNDOUAGY-UHFFFAOYSA-N
SMILES:N=c1ccn(O)cc1