Informazioni sul prodotto
Nome:2-Acetylcyclopentanone
Marchio:Biosynth
Descrizione:2-Acetylcyclopentanone is a chemical compound that has been studied for its potential use as an anti-infective agent. This compound has shown to inhibit the growth of bacteria and fungi, including Candida albicans, Staphylococcus aureus, and Aspergillus fumigatus. 2-Acetylcyclopentanone also inhibits the production of reactive oxygen species by mitochondria in rat striatal cells. The mechanism of action is not yet known but may involve the formation of an acid complex with metal hydroxides, which can be found in fatty acids and radiation particles. 2-Acetylcyclopentanone is not active against Gram-positive or Gram-negative bacteria because it does not cross the cell membrane. It is also poorly absorbed into the bloodstream because it is rapidly converted to acetolactate within cells.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:126.15 g/mol
Formula:C7H10O2
Purezza:Min. 95%
InChI:InChI=1S/C7H10O2/c1-5(8)6-3-2-4-7(6)9/h6H,2-4H2,1H3
InChI key:InChIKey=OSWDNIFICGLKEE-UHFFFAOYSA-N
SMILES:CC(=O)C1CCCC1=O