Informazioni sul prodotto
Nome:2-Bromo-3-hexylthiophene
Marchio:Biosynth
Descrizione:2-Bromo-3-hexylthiophene is an organic compound that has a boiling point of 109.8°C and a melting point of -25°C. It is a colorless liquid with a pungent odor. This compound reacts with palladium complexes to form an unsymmetrical alkyl group at the 3 position on the thiophene ring. The reaction proceeds through a reductive elimination mechanism, forming an alcohol or acetate as the termination product. 2-Bromo-3-hexylthiophene can be used to synthesize monomers for the production of polymers and elastomers, such as polystyrene and styrene butadiene rubber (SBR).
2-Bromo-3-hexylthiophene is soluble in ethanol, acetone, ether, benzene, chloroform and carbon tetrachloride.
2-Bromo-3-hexylthiophene is soluble in ethanol, acetone, ether, benzene, chloroform and carbon tetrachloride.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:247.2 g/mol
Formula:C10H15BrS
Purezza:Min. 95%
InChI:InChI=1S/C10H15BrS/c1-2-3-4-5-6-9-7-8-12-10(9)11/h7-8H,2-6H2,1H3
InChI key:InChIKey=XQJNXCHDODCAJF-UHFFFAOYSA-N
SMILES:CCCCCCc1ccsc1Br