Informazioni sul prodotto
Nome:4-Benzylaniline
Marchio:Biosynth
Descrizione:4-Benzylaniline is an amine compound that can be used as a precursor to the synthesis of diazo compounds. 4-Benzylaniline can be synthesized by the reaction of benzaldehyde and ammonia chloride. Alternatively, it can be made by nitration of aniline in the presence of hydrochloric acid. This compound is soluble in water and methanol but insoluble in ether. It is also soluble in concentrated hydrochloric acid, but not in dilute hydrochloric acid. The solubility of this compound increases with increasing temperature and decreasing pH. The melting point is -14 degrees Celsius, and the boiling point is 190 degrees Celsius at a pressure of one atmosphere. 4-Benzylaniline has a molecular weight of 138 g/mol.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:183.25 g/mol
Formula:C13H13N
Purezza:Min. 95%
InChI:InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2
InChI key:InChIKey=WDTRNCFZFQIWLM-UHFFFAOYSA-N
SMILES:Nc1ccc(Cc2ccccc2)cc1