Informazioni sul prodotto
Nome:Bromochlorophenol blue
Marchio:Biosynth
Descrizione:Bromochlorophenol blue is an antimicrobial agent that is used in clinical chemistry and analytical chemistry. It is a cationic surfactant that acts as a dye to indicate the presence of free bromophenols. Bromochlorophenol blue has been shown to be more sensitive than other dyes, such as basic dyes, for the detection of bromophenols. Bromochlorophenol blue also reacts with hydroxide solution to produce a blue color, which can be detected by flow assay. A hydrogen bond forms when the bromine atom of bromochlorophenol blue interacts with the hydroxide ion from sodium hydroxide solution. The formation rate can be determined by analyzing kinetic data.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:581.06 g/mol
Formula:C19H10Br2Cl2O5S
Purezza:Min. 95%
InChI:InChI=1S/C19H10Br2Cl2O5S/c20-12-5-9(7-14(22)17(12)24)19(10-6-13(21)18(25)15(23)8-10)11-3-1-2-4-16(11)29(26,27)28-19/h1-8,24-25H
InChI key:InChIKey=MDGFKZKMIQQRPU-UHFFFAOYSA-N
SMILES:O=S1(=O)OC(c2cc(Cl)c(O)c(Br)c2)(c2cc(Cl)c(O)c(Br)c2)c2ccccc21