Informazioni sul prodotto
Nome:3-Benzoylpropanoic acid
Sinonimi:
- 4-Oxo-4-phenyl-butanoic acid4-Oxo-4-phenyl-butyric acid4-Phenyl-4-oxobutanoic acid
Marchio:Biosynth
Descrizione:3-Benzoylpropanoic acid is an inhibitor of the enzyme phosphatase. It binds to the hydroxyl group of serine residues on the enzyme and prevents it from catalyzing reactions. This inhibition can lead to mitochondrial dysfunction, which may be involved in the development of autoimmune diseases such as lupus erythematosus and rheumatoid arthritis. 3-Benzoylpropanoic acid has been used successfully to treat choroidal neovascularization, a condition that causes vision loss due to abnormal blood vessel growth in the eye. The optimum pH for this drug is 7.5 and it can be broken down by a phosphatase enzyme into 2-benzoylbenzoic acid, a metabolite that is less active than 3-benzoylpropanoic acid.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:178.18 g/mol
Formula:C10H10O3
Purezza:Min. 95%
InChI:InChI=1S/C10H10O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)
InChI key:InChIKey=KMQLIDDEQAJAGJ-UHFFFAOYSA-N
SMILES:O=C(O)CCC(=O)c1ccccc1