Informazioni sul prodotto
Nome:3-Bromo-2-bromomethyl-propionic acid
Marchio:Biosynth
Descrizione:3-Bromo-2-bromomethyl-propionic acid (3BrPA) is a synthetic molecule that has been used for the synthesis of organic compounds. 3BrPA has shown to be selective in reactions involving electron transfer and bond cleavage. This compound is also able to form covalent bonds with oxygen, nitrogen, and sulfur atoms, which makes it suitable for use in synthesizing heterocycles. 3BrPA can be used as a precursor for other molecules by introducing substituents at the 2 position. The presence of functional groups on the molecule allows for further manipulations and modifications in order to create new molecules with desired properties. 3BrPA also has constant molecular weight and is nonpolar, making it ideal for biological applications such as Alzheimer's disease research.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:245.9 g/mol
Formula:C4H6Br2O2
Purezza:Min. 95%
InChI:InChI=1S/C4H6Br2O2/c5-1-3(2-6)4(7)8/h3H,1-2H2,(H,7,8)
InChI key:InChIKey=QQZJWQCLWOQDQV-UHFFFAOYSA-N
SMILES:O=C(O)C(CBr)CBr