Informazioni sul prodotto
Nome:5-Bromo-2-chloropyrazine
Marchio:Biosynth
Descrizione:5-Bromo-2-chloropyrazine is a chemical with the molecular formula CClN. It is used for the synthesis of organic compounds, including pharmaceuticals. 5-Bromo-2-chloropyrazine is synthesized by reacting potassium and hydrochloric acid with formamide, which yields formic acid and 5-bromo-2-chloropyrazine. The reaction proceeds as follows:
5Br + 2KOH + HOCH(CH)COH → CHCl + HBrO + KBrO
The compound can be hydrolyzed to produce pyrazine, which can then be used in the synthesis of other chemicals. Hydrolysis is achieved through heating the compound in water or aqueous sodium hydroxide solution at 100°C.
5Br + 2KOH + HOCH(CH)COH → CHCl + HBrO + KBrO
The compound can be hydrolyzed to produce pyrazine, which can then be used in the synthesis of other chemicals. Hydrolysis is achieved through heating the compound in water or aqueous sodium hydroxide solution at 100°C.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:193.43 g/mol
Formula:C4H2BrClN2
Purezza:Min. 95%
InChI:InChI=1S/C4H2BrClN2/c5-3-1-8-4(6)2-7-3/h1-2H
InChI key:InChIKey=UXCPLGLOAZWCKO-UHFFFAOYSA-N
SMILES:Clc1cnc(Br)cn1