Informazioni sul prodotto
Nome:6-Chloronicotinic acid
Marchio:Biosynth
Descrizione:6-Chloronicotinic acid is a chemical compound that can be used as an analytical method. It is a fluorescent probe that is used to identify the presence of imidacloprid in a sample. This compound reacts with imidacloprid and changes its fluorescence properties. The 6-chloronicotinic acid fluoresces green when it binds to imidacloprid, which has been shown to have toxicological properties. 6-Chloronicotinic acid is also used in determining the concentration of neonicotinoids in samples by using a reaction mechanism involving hydrogen peroxide and hypochlorous acid. The reaction produces chlorinated products that are measured using a fluorescence detector. This process can be done without any interfering matrix effect, making it more accurate than traditional methods.
6-Chloronicotinic acid can also be used for the blood sampling of animals, such as mice, due to its synchronous fluorescence property. It binds with hem
6-Chloronicotinic acid can also be used for the blood sampling of animals, such as mice, due to its synchronous fluorescence property. It binds with hem
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:157.55 g/mol
Formula:C6H4ClNO2
Purezza:Min. 98 Area-%
Colore/Forma:Powder
InChI:InChI=1S/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10)
InChI key:InChIKey=UAWMVMPAYRWUFX-UHFFFAOYSA-N
SMILES:O=C(O)c1ccc(Cl)nc1