

Informazioni sul prodotto
Nome:4-Chloro-2-fluorobenzenesulphonyl chloride
Marchio:Biosynth
Descrizione:4-Chloro-2-fluorobenzenesulphonyl chloride is a chlorinating agent that is used as a catalyst in the synthesis of sulfonyl chlorides. The purity of the product can be improved by recrystallizing it from an acid solution, using a suitable catalyst. This process flow can be synthesized by reacting 4-chloro-2-fluorobenzenesulfonic acid with thionyl chloride in the presence of a base, such as pyridine. The substance is acidic and catalytic, which enables it to react with other substances. 4-Chloro-2-fluorobenzenesulphonyl chloride reacts with ammonia to form ammonium chloride, which is then converted into ammonium sulfate during acidification.
4-Chloro-2-fluorobenzenesulphonyl chloride does not contain chlorine or hydrogen atoms and is not an oxidizer or reducer.
4-Chloro-2-fluorobenzenesulphonyl chloride does not contain chlorine or hydrogen atoms and is not an oxidizer or reducer.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:229.06 g/mol
Formula:C6H3Cl2FO2S
Purezza:Min. 95%
InChI:InChI=1S/C6H3Cl2FO2S/c7-4-1-2-6(5(9)3-4)12(8,10)11/h1-3H
InChI key:InChIKey=ZFZRENUEJCOCRE-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)c1ccc(Cl)cc1F