

Informazioni sul prodotto
Nome:6-Chloro-4-hydroxycoumarin
Marchio:Biosynth
Descrizione:6-Chloro-4-hydroxycoumarin is a tetronic acid that has been synthesized by the activation of hydroxy groups with palladium complexes. It is a derivative of coumarin and has been shown to be active against Gram-positive bacteria, such as Staphylococcus aureus, and Gram-negative bacteria, such as Escherichia coli. 6-Chloro-4-hydroxycoumarin inhibits bacterial growth by binding to chloride ions in the cell wall and preventing them from being incorporated into the peptidoglycan layer of the cell wall. This drug also binds to metal ions, such as copper or zinc, which are involved in the formation of enzymes and other proteins necessary for cell growth. The stereoisomers of this drug have different activities against bacteria; for example, the (S) stereoisomer is more potent than the (R) stereoisomer.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:196.59 g/mol
Formula:C9H5ClO3
Purezza:Min. 95%
InChI:InChI=1S/C9H5ClO3/c10-5-1-2-8-6(3-5)7(11)4-9(12)13-8/h1-4,11H
InChI key:InChIKey=HUMZENGQNOATEQ-UHFFFAOYSA-N
SMILES:O=c1cc(O)c2cc(Cl)ccc2o1