

Informazioni sul prodotto
Nome:2-Cyanopropionic acid ethyl ester
Marchio:Biosynth
Descrizione:2-Cyanopropionic acid ethyl ester is a monomer, soluble guanylate cyclase activator that alkylates the active methylene group of guanylate cyclase. It has been shown to be active against infectious diseases such as dengue fever, malaria and tuberculosis. 2-Cyanopropionic acid ethyl ester is a ruthenium complex that interacts with ferrocene and fatty acids to form an activated methylene group. This bond cleavage leads to the formation of an electron deficient molecule that binds to DNA and inhibits the synthesis of RNA by blocking the binding site for RNA polymerase.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:127.14 g/mol
Formula:C6H9NO2
Purezza:Min. 95%
InChI:InChI=1S/C6H12O2/c1-4-8-6(7)5(2)3/h5H,4H2,1-3H3
InChI key:InChIKey=WDAXFOBOLVPGLV-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C)C#N