

Informazioni sul prodotto
Nome:2-(4-Chlorophenyl)-2-oxoacetic acid
Marchio:Biosynth
Descrizione:2-(4-Chlorophenyl)-2-oxoacetic acid is a compound with the molecular formula C6H5ClO2. It is a white crystalline solid that has a melting point of 122°C. When 2-(4-chlorophenyl)-2-oxoacetic acid is dissolved in water, it forms an acidic solution with a pH of 3.7. This chemical can be used to create disulfides and pyridazine derivatives. Disulfides are formed by the reaction of two molecules of 2-(4-chlorophenyl)-2-oxoacetic acid, while pyridazine derivatives are formed by the reaction of one molecule of 2-(4-chlorophenyl)-2-oxoacetic acid and one molecule of an amine (NH3). The functional groups present in this compound include: disulfide (SS), pyridine (N), and 4 chlorines (Cl). Micelles
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:184.58 g/mol
Formula:C8H5ClO3
Purezza:Min. 95%
InChI:InChI=1S/C8H5ClO3/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4H,(H,11,12)
InChI key:InChIKey=RSAXVDMWQCQTDT-UHFFFAOYSA-N
SMILES:O=C(O)C(=O)c1ccc(Cl)cc1