Informazioni sul prodotto
Nome:2-(Chloromethyl)-2-methyloxirane
Sinonimi:
- 2-Methylepichlorohydrin
Marchio:Biosynth
Descrizione:2-(Chloromethyl)-2-methyloxirane is a reactive aliphatic hydrocarbon that reacts with chloride to form an ether linkage. It is used as a cross-linking agent in the production of polycarboxylic acid particles and hydroxylated polymers, which are used in many industries. 2-(Chloromethyl)-2-methyloxirane can be synthesized by reacting copper chloride with hydrogen tartrate, followed by hydrochloric acid. The reaction mechanism is shown below:
Reaction mechanism for 2-(chloromethyl)-2-methyloxirane
This molecule has a reactive functional group (hydroxyl) and so can undergo reactions such as photochemical reactions, which is how it may be used to create particle films. The viscosity of 2-(chloromethyl)-2-methyloxirane has been measured at 1.0 cP (centipoise).
Reaction mechanism for 2-(chloromethyl)-2-methyloxirane
This molecule has a reactive functional group (hydroxyl) and so can undergo reactions such as photochemical reactions, which is how it may be used to create particle films. The viscosity of 2-(chloromethyl)-2-methyloxirane has been measured at 1.0 cP (centipoise).
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:106.55 g/mol
Formula:C4H7ClO
Purezza:Min. 95%
InChI:InChI=1S/C4H7ClO/c1-4(2-5)3-6-4/h2-3H2,1H3
InChI key:InChIKey=VVHFXJOCUKBZFS-UHFFFAOYSA-N
SMILES:CC1(CCl)CO1